C15H24N4OS — CID 45239866
2-methyl-5-[4-[(thiolan-3-ylamino)methyl]piperidin-1-yl]pyridazin-3-one (PubChem CID 45239866) has the molecular formula C15H24N4OS and a molecular weight of 308.45 g/mol. Its IUPAC name is 2-methyl-5-[4-[(thiolan-3-ylamino)methyl]piperidin-1-yl]pyridazin-3-one.
| Compound Name | 2-methyl-5-[4-[(thiolan-3-ylamino)methyl]piperidin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 45239866 |
| Molecular Formula | C15H24N4OS |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 2-methyl-5-[4-[(thiolan-3-ylamino)methyl]piperidin-1-yl]pyridazin-3-one |
| SMILES | Cn1ncc(N2CCC(CNC3CCSC3)CC2)cc1=O |
| InChI | InChI=1S/C15H24N4OS/c1-18-15(20)8-14(10-17-18)19-5-2-12(3-6-19)9-16-13-4-7-21-11-13/h8,10,12-13,16H,2-7,9,11H2,1H3 |
| InChIKey | HMTIKNOSSRLHNC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |