C24H37N3O4 — CID 45240534
ethyl 4-[[6-[2-(cyclohexen-1-yl)acetyl]-6-azaspiro[2.5]octane-2-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 45240534) has the molecular formula C24H37N3O4 and a molecular weight of 431.58 g/mol. Its IUPAC name is ethyl 4-[[6-[2-(cyclohexen-1-yl)acetyl]-6-azaspiro[2.5]octane-2-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[6-[2-(cyclohexen-1-yl)acetyl]-6-azaspiro[2.5]octane-2-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 45240534 |
| Molecular Formula | C24H37N3O4 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | ethyl 4-[[6-[2-(cyclohexen-1-yl)acetyl]-6-azaspiro[2.5]octane-2-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)C2CC23CCN(C(=O)CC2=CCCCC2)CC3)CC1 |
| InChI | InChI=1S/C24H37N3O4/c1-2-31-23(30)27-12-8-19(9-13-27)25-22(29)20-17-24(20)10-14-26(15-11-24)21(28)16-18-6-4-3-5-7-18/h6,19-20H,2-5,7-17H2,1H3,(H,25,29) |
| InChIKey | DQFQHZQPCKAZAV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|