C23H18N2O6S2 — CID 4524105
4-(1,3-dithian-2-ylidene)-1,7-bis(3-nitrophenyl)hepta-1,6-diene-3,5-dione (PubChem CID 4524105) has the molecular formula C23H18N2O6S2 and a molecular weight of 482.54 g/mol. Its IUPAC name is 4-(1,3-dithian-2-ylidene)-1,7-bis(3-nitrophenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | 4-(1,3-dithian-2-ylidene)-1,7-bis(3-nitrophenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 4524105 |
| Molecular Formula | C23H18N2O6S2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | 4-(1,3-dithian-2-ylidene)-1,7-bis(3-nitrophenyl)hepta-1,6-diene-3,5-dione |
| SMILES | O=C(C=Cc1cccc([N+](=O)[O-])c1)C(C(=O)C=Cc1cccc([N+](=O)[O-])c1)=C1SCCCS1 |
| InChI | InChI=1S/C23H18N2O6S2/c26-20(10-8-16-4-1-6-18(14-16)24(28)29)22(23-32-12-3-13-33-23)21(27)11-9-17-5-2-7-19(15-17)25(30)31/h1-2,4-11,14-15H,3,12-13H2 |
| InChIKey | BZOANZRYNTXIJM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|