C30H29NO3 — CID 45241536
1,2-dihydroacenaphthylen-5-yl-[1-[4-(3-hydroxy-3-methylbut-1-ynyl)benzoyl]piperidin-3-yl]methanone (PubChem CID 45241536) has the molecular formula C30H29NO3 and a molecular weight of 451.57 g/mol. Its IUPAC name is 1,2-dihydroacenaphthylen-5-yl-[1-[4-(3-hydroxy-3-methylbut-1-ynyl)benzoyl]piperidin-3-yl]methanone.
| Compound Name | 1,2-dihydroacenaphthylen-5-yl-[1-[4-(3-hydroxy-3-methylbut-1-ynyl)benzoyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 45241536 |
| Molecular Formula | C30H29NO3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 1,2-dihydroacenaphthylen-5-yl-[1-[4-(3-hydroxy-3-methylbut-1-ynyl)benzoyl]piperidin-3-yl]methanone |
| SMILES | CC(C)(O)C#Cc1ccc(C(=O)N2CCCC(C(=O)c3ccc4c5c(cccc35)CC4)C2)cc1 |
| InChI | InChI=1S/C30H29NO3/c1-30(2,34)17-16-20-8-10-23(11-9-20)29(33)31-18-4-6-24(19-31)28(32)26-15-14-22-13-12-21-5-3-7-25(26)27(21)22/h3,5,7-11,14-15,24,34H,4,6,12-13,18-19H2,1-2H3 |
| InChIKey | GCSHNECTYFKPQF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|