About 5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-cyclopentylpiperidin-2-one
5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-cyclopentylpiperidin-2-one (PubChem CID 45241633) has the molecular formula C21H32N2O2
and a molecular weight of 344.50 g/mol. Its IUPAC name is 5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-cyclopentylpiperidin-2-one.
Molecular Properties
| Compound Name | 5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-cyclopentylpiperidin-2-one |
| PubChem CID | 45241633 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-cyclopentylpiperidin-2-one |
| SMILES | C=CCC1(CC=C)CCCN1C(=O)C1CCC(=O)N(C2CCCC2)C1 |
| InChI | InChI=1S/C21H32N2O2/c1-3-12-21(13-4-2)14-7-15-23(21)20(25)17-10-11-19(24)22(16-17)18-8-5-6-9-18/h3-4,17-18H,1-2,5-16H2 |
| InChIKey | RLODQOOJGGBVAV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-cyclopentylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-cyclopentylpiperidin-2-one?
The IUPAC name of 5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-cyclopentylpiperidin-2-one (CID 45241633) is 5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-cyclopentylpiperidin-2-one.
What is the SMILES notation for 5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-cyclopentylpiperidin-2-one?
The canonical SMILES for 5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-cyclopentylpiperidin-2-one is C=CCC1(CC=C)CCCN1C(=O)C1CCC(=O)N(C2CCCC2)C1.
What is the InChIKey of 5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-cyclopentylpiperidin-2-one?
The InChIKey is RLODQOOJGGBVAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32N2O2/c1-3-12-21(13-4-2)14-7-15-23(21)20(25)17-10-11-19(24)22(16-17)18-8-5-6-9-18/h3-4,17-18H,1-2,5-16H2.
What are the key properties of 5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-cyclopentylpiperidin-2-one?
5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-cyclopentylpiperidin-2-one has a molecular weight of 344.50 g/mol, XLogP of 3.68, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-cyclopentylpiperidin-2-one is sourced from PubChem (CID 45241633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).