About 6-[3-[2-(2,6-difluorophenyl)ethyl]piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one
6-[3-[2-(2,6-difluorophenyl)ethyl]piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one (PubChem CID 45241828) has the molecular formula C19H23F2N3O2
and a molecular weight of 363.41 g/mol. Its IUPAC name is 6-[3-[2-(2,6-difluorophenyl)ethyl]piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one.
Molecular Properties
| Compound Name | 6-[3-[2-(2,6-difluorophenyl)ethyl]piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one |
| PubChem CID | 45241828 |
| Molecular Formula | C19H23F2N3O2 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 6-[3-[2-(2,6-difluorophenyl)ethyl]piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one |
| SMILES | CN1N=C(C(=O)N2CCCC(CCc3c(F)cccc3F)C2)CCC1=O |
| InChI | InChI=1S/C19H23F2N3O2/c1-23-18(25)10-9-17(22-23)19(26)24-11-3-4-13(12-24)7-8-14-15(20)5-2-6-16(14)21/h2,5-6,13H,3-4,7-12H2,1H3 |
| InChIKey | URPFPARMTJTZMJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[3-[2-(2,6-difluorophenyl)ethyl]piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-[2-(2,6-difluorophenyl)ethyl]piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one?
The IUPAC name of 6-[3-[2-(2,6-difluorophenyl)ethyl]piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one (CID 45241828) is 6-[3-[2-(2,6-difluorophenyl)ethyl]piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one.
What is the SMILES notation for 6-[3-[2-(2,6-difluorophenyl)ethyl]piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one?
The canonical SMILES for 6-[3-[2-(2,6-difluorophenyl)ethyl]piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one is CN1N=C(C(=O)N2CCCC(CCc3c(F)cccc3F)C2)CCC1=O.
What is the InChIKey of 6-[3-[2-(2,6-difluorophenyl)ethyl]piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one?
The InChIKey is URPFPARMTJTZMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23F2N3O2/c1-23-18(25)10-9-17(22-23)19(26)24-11-3-4-13(12-24)7-8-14-15(20)5-2-6-16(14)21/h2,5-6,13H,3-4,7-12H2,1H3.
What are the key properties of 6-[3-[2-(2,6-difluorophenyl)ethyl]piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one?
6-[3-[2-(2,6-difluorophenyl)ethyl]piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one has a molecular weight of 363.41 g/mol, XLogP of 2.74, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-[2-(2,6-difluorophenyl)ethyl]piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one is sourced from PubChem (CID 45241828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).