C27H21F3N4O — CID 45242127
[3-(5-phenyl-2-pyridin-4-ylpyrimidin-4-yl)piperidin-1-yl]-(2,3,6-trifluorophenyl)methanone (PubChem CID 45242127) has the molecular formula C27H21F3N4O and a molecular weight of 474.49 g/mol. Its IUPAC name is [3-(5-phenyl-2-pyridin-4-ylpyrimidin-4-yl)piperidin-1-yl]-(2,3,6-trifluorophenyl)methanone.
| Compound Name | [3-(5-phenyl-2-pyridin-4-ylpyrimidin-4-yl)piperidin-1-yl]-(2,3,6-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 45242127 |
| Molecular Formula | C27H21F3N4O |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | [3-(5-phenyl-2-pyridin-4-ylpyrimidin-4-yl)piperidin-1-yl]-(2,3,6-trifluorophenyl)methanone |
| SMILES | O=C(c1c(F)ccc(F)c1F)N1CCCC(c2nc(-c3ccncc3)ncc2-c2ccccc2)C1 |
| InChI | InChI=1S/C27H21F3N4O/c28-21-8-9-22(29)24(30)23(21)27(35)34-14-4-7-19(16-34)25-20(17-5-2-1-3-6-17)15-32-26(33-25)18-10-12-31-13-11-18/h1-3,5-6,8-13,15,19H,4,7,14,16H2 |
| InChIKey | ILSWLYOODTVKQJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|