About ethyl 4-[1-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]piperidin-3-yl]piperazine-1-carboxylate
ethyl 4-[1-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]piperidin-3-yl]piperazine-1-carboxylate (PubChem CID 45242888) has the molecular formula C26H40N4O2
and a molecular weight of 440.63 g/mol. Its IUPAC name is ethyl 4-[1-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]piperidin-3-yl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[1-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]piperidin-3-yl]piperazine-1-carboxylate |
| PubChem CID | 45242888 |
| Molecular Formula | C26H40N4O2 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.32 |
| IUPAC Name | ethyl 4-[1-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]piperidin-3-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C2CCCN(C3CCN(c4ccc5c(c4)CCC5)CC3)C2)CC1 |
| InChI | InChI=1S/C26H40N4O2/c1-2-32-26(31)29-17-15-28(16-18-29)25-7-4-12-30(20-25)23-10-13-27(14-11-23)24-9-8-21-5-3-6-22(21)19-24/h8-9,19,23,25H,2-7,10-18,20H2,1H3 |
| InChIKey | FTMWWCLVAOJTSB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[1-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]piperidin-3-yl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[1-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]piperidin-3-yl]piperazine-1-carboxylate?
The IUPAC name of ethyl 4-[1-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]piperidin-3-yl]piperazine-1-carboxylate (CID 45242888) is ethyl 4-[1-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]piperidin-3-yl]piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-[1-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]piperidin-3-yl]piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-[1-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]piperidin-3-yl]piperazine-1-carboxylate is CCOC(=O)N1CCN(C2CCCN(C3CCN(c4ccc5c(c4)CCC5)CC3)C2)CC1.
What is the InChIKey of ethyl 4-[1-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]piperidin-3-yl]piperazine-1-carboxylate?
The InChIKey is FTMWWCLVAOJTSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H40N4O2/c1-2-32-26(31)29-17-15-28(16-18-29)25-7-4-12-30(20-25)23-10-13-27(14-11-23)24-9-8-21-5-3-6-22(21)19-24/h8-9,19,23,25H,2-7,10-18,20H2,1H3.
What are the key properties of ethyl 4-[1-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]piperidin-3-yl]piperazine-1-carboxylate?
ethyl 4-[1-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]piperidin-3-yl]piperazine-1-carboxylate has a molecular weight of 440.63 g/mol, XLogP of 3.38, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[1-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]piperidin-3-yl]piperazine-1-carboxylate is sourced from PubChem (CID 45242888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).