C43H31ClN2O7 — CID 4524340
3-[8-(3-chlorophenyl)-6-(4-hydroxynaphthalen-1-yl)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid (PubChem CID 4524340) has the molecular formula C43H31ClN2O7 and a molecular weight of 723.18 g/mol. Its IUPAC name is 3-[8-(3-chlorophenyl)-6-(4-hydroxynaphthalen-1-yl)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid.
| Compound Name | 3-[8-(3-chlorophenyl)-6-(4-hydroxynaphthalen-1-yl)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 4524340 |
| Molecular Formula | C43H31ClN2O7 |
| Molecular Weight | 723.18 g/mol |
| Exact Mass | 722.18 |
| IUPAC Name | 3-[8-(3-chlorophenyl)-6-(4-hydroxynaphthalen-1-yl)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(N2C(=O)C3CC=C4C(CC5C(=O)N(c6cccc(Cl)c6)C(=O)C5(c5ccccc5)C4c4ccc(O)c5ccccc45)C3C2=O)c1 |
| InChI | InChI=1S/C43H31ClN2O7/c44-25-11-7-13-27(21-25)46-39(49)34-22-33-31(16-17-32-36(33)40(50)45(38(32)48)26-12-6-8-23(20-26)41(51)52)37(43(34,42(46)53)24-9-2-1-3-10-24)30-18-19-35(47)29-15-5-4-14-28(29)30/h1-16,18-21,32-34,36-37,47H,17,22H2,(H,51,52) |
| InChIKey | WQRRZVKIXBJXOK-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.18 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|