C17H16N4O4 — CID 45243417
3-[2-[[2-(2-methylphenoxy)-3-pyridinyl]methylamino]-2-oxoethyl]oxadiazol-3-ium-5-olate (PubChem CID 45243417) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is 3-[2-[[2-(2-methylphenoxy)-3-pyridinyl]methylamino]-2-oxoethyl]oxadiazol-3-ium-5-olate.
| Compound Name | 3-[2-[[2-(2-methylphenoxy)-3-pyridinyl]methylamino]-2-oxoethyl]oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 45243417 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 3-[2-[[2-(2-methylphenoxy)-3-pyridinyl]methylamino]-2-oxoethyl]oxadiazol-3-ium-5-olate |
| SMILES | Cc1ccccc1Oc1ncccc1CNC(=O)C[n+]1cc([O-])on1 |
| InChI | InChI=1S/C17H16N4O4/c1-12-5-2-3-7-14(12)24-17-13(6-4-8-18-17)9-19-15(22)10-21-11-16(23)25-20-21/h2-8,11H,9-10H2,1H3,(H-,19,20,22,23) |
| InChIKey | FPMWMOLYBYAANI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|