C22H24FN3O — CID 45244149
N-[[3-(3-fluorophenyl)-1-(3-methylphenyl)pyrazol-4-yl]methyl]-1-(oxolan-2-yl)methanamine (PubChem CID 45244149) has the molecular formula C22H24FN3O and a molecular weight of 365.45 g/mol. Its IUPAC name is N-[[3-(3-fluorophenyl)-1-(3-methylphenyl)pyrazol-4-yl]methyl]-1-(oxolan-2-yl)methanamine.
| Compound Name | N-[[3-(3-fluorophenyl)-1-(3-methylphenyl)pyrazol-4-yl]methyl]-1-(oxolan-2-yl)methanamine |
|---|---|
| PubChem CID | 45244149 |
| Molecular Formula | C22H24FN3O |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N-[[3-(3-fluorophenyl)-1-(3-methylphenyl)pyrazol-4-yl]methyl]-1-(oxolan-2-yl)methanamine |
| SMILES | Cc1cccc(-n2cc(CNCC3CCCO3)c(-c3cccc(F)c3)n2)c1 |
| InChI | InChI=1S/C22H24FN3O/c1-16-5-2-8-20(11-16)26-15-18(13-24-14-21-9-4-10-27-21)22(25-26)17-6-3-7-19(23)12-17/h2-3,5-8,11-12,15,21,24H,4,9-10,13-14H2,1H3 |
| InChIKey | VRGYYZUVTHSXJM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |