C25H27N3O2 — CID 45244552
3-(2-benzyl-5-oxopyrrolidin-2-yl)-N-methyl-N-(quinolin-5-ylmethyl)propanamide (PubChem CID 45244552) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is 3-(2-benzyl-5-oxopyrrolidin-2-yl)-N-methyl-N-(quinolin-5-ylmethyl)propanamide.
| Compound Name | 3-(2-benzyl-5-oxopyrrolidin-2-yl)-N-methyl-N-(quinolin-5-ylmethyl)propanamide |
|---|---|
| PubChem CID | 45244552 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 3-(2-benzyl-5-oxopyrrolidin-2-yl)-N-methyl-N-(quinolin-5-ylmethyl)propanamide |
| SMILES | CN(Cc1cccc2ncccc12)C(=O)CCC1(Cc2ccccc2)CCC(=O)N1 |
| InChI | InChI=1S/C25H27N3O2/c1-28(18-20-9-5-11-22-21(20)10-6-16-26-22)24(30)13-15-25(14-12-23(29)27-25)17-19-7-3-2-4-8-19/h2-11,16H,12-15,17-18H2,1H3,(H,27,29) |
| InChIKey | JWFWVXVEOMVUJN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |