C24H29N3O2 — CID 45244864
4-(2,2-diphenylethyl)-3-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-2-one (PubChem CID 45244864) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is 4-(2,2-diphenylethyl)-3-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-2-one.
| Compound Name | 4-(2,2-diphenylethyl)-3-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-2-one |
|---|---|
| PubChem CID | 45244864 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 4-(2,2-diphenylethyl)-3-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-2-one |
| SMILES | O=C1NCCN(CC(c2ccccc2)c2ccccc2)C1CC(=O)N1CCCC1 |
| InChI | InChI=1S/C24H29N3O2/c28-23(26-14-7-8-15-26)17-22-24(29)25-13-16-27(22)18-21(19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-6,9-12,21-22H,7-8,13-18H2,(H,25,29) |
| InChIKey | IGSRRDWKJHVUJQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |