C19H25ClN2O3 — CID 45245142
1-[(4-chlorophenyl)methyl]-N-(4-hydroxycyclohexyl)-6-oxopiperidine-3-carboxamide (PubChem CID 45245142) has the molecular formula C19H25ClN2O3 and a molecular weight of 364.87 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-(4-hydroxycyclohexyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-(4-hydroxycyclohexyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 45245142 |
| Molecular Formula | C19H25ClN2O3 |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-(4-hydroxycyclohexyl)-6-oxopiperidine-3-carboxamide |
| SMILES | O=C(NC1CCC(O)CC1)C1CCC(=O)N(Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H25ClN2O3/c20-15-4-1-13(2-5-15)11-22-12-14(3-10-18(22)24)19(25)21-16-6-8-17(23)9-7-16/h1-2,4-5,14,16-17,23H,3,6-12H2,(H,21,25) |
| InChIKey | JCBTVPUJRVRMLN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |