About 2,4-diphenyl-4H-chromene
2,4-diphenyl-4H-chromene (PubChem CID 4524534) has the molecular formula C21H16O
and a molecular weight of 284.36 g/mol. Its IUPAC name is 2,4-diphenyl-4H-chromene.
Molecular Properties
| Compound Name | 2,4-diphenyl-4H-chromene |
| PubChem CID | 4524534 |
| Molecular Formula | C21H16O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2,4-diphenyl-4H-chromene |
| SMILES | C1=C(c2ccccc2)Oc2ccccc2C1c1ccccc1 |
| InChI | InChI=1S/C21H16O/c1-3-9-16(10-4-1)19-15-21(17-11-5-2-6-12-17)22-20-14-8-7-13-18(19)20/h1-15,19H |
| InChIKey | PZZKQIVCCJKOFC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-diphenyl-4H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diphenyl-4H-chromene?
The IUPAC name of 2,4-diphenyl-4H-chromene (CID 4524534) is 2,4-diphenyl-4H-chromene.
What is the SMILES notation for 2,4-diphenyl-4H-chromene?
The canonical SMILES for 2,4-diphenyl-4H-chromene is C1=C(c2ccccc2)Oc2ccccc2C1c1ccccc1.
What is the InChIKey of 2,4-diphenyl-4H-chromene?
The InChIKey is PZZKQIVCCJKOFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16O/c1-3-9-16(10-4-1)19-15-21(17-11-5-2-6-12-17)22-20-14-8-7-13-18(19)20/h1-15,19H.
What are the key properties of 2,4-diphenyl-4H-chromene?
2,4-diphenyl-4H-chromene has a molecular weight of 284.36 g/mol, XLogP of 5.25, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diphenyl-4H-chromene is sourced from PubChem (CID 4524534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).