About 2-N,6-N-bis(pyridin-3-ylmethyl)pyridine-2,6-dicarboxamide
2-N,6-N-bis(pyridin-3-ylmethyl)pyridine-2,6-dicarboxamide (PubChem CID 4524554) has the molecular formula C19H17N5O2
and a molecular weight of 347.38 g/mol. Its IUPAC name is 2-N,6-N-bis(pyridin-3-ylmethyl)pyridine-2,6-dicarboxamide.
Molecular Properties
| Compound Name | 2-N,6-N-bis(pyridin-3-ylmethyl)pyridine-2,6-dicarboxamide |
| PubChem CID | 4524554 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 2-N,6-N-bis(pyridin-3-ylmethyl)pyridine-2,6-dicarboxamide |
| SMILES | O=C(NCc1cccnc1)c1cccc(C(=O)NCc2cccnc2)n1 |
| InChI | InChI=1S/C19H17N5O2/c25-18(22-12-14-4-2-8-20-10-14)16-6-1-7-17(24-16)19(26)23-13-15-5-3-9-21-11-15/h1-11H,12-13H2,(H,22,25)(H,23,26) |
| InChIKey | KZAXYFUOEBANOF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-N,6-N-bis(pyridin-3-ylmethyl)pyridine-2,6-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,6-N-bis(pyridin-3-ylmethyl)pyridine-2,6-dicarboxamide?
The IUPAC name of 2-N,6-N-bis(pyridin-3-ylmethyl)pyridine-2,6-dicarboxamide (CID 4524554) is 2-N,6-N-bis(pyridin-3-ylmethyl)pyridine-2,6-dicarboxamide.
What is the SMILES notation for 2-N,6-N-bis(pyridin-3-ylmethyl)pyridine-2,6-dicarboxamide?
The canonical SMILES for 2-N,6-N-bis(pyridin-3-ylmethyl)pyridine-2,6-dicarboxamide is O=C(NCc1cccnc1)c1cccc(C(=O)NCc2cccnc2)n1.
What is the InChIKey of 2-N,6-N-bis(pyridin-3-ylmethyl)pyridine-2,6-dicarboxamide?
The InChIKey is KZAXYFUOEBANOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N5O2/c25-18(22-12-14-4-2-8-20-10-14)16-6-1-7-17(24-16)19(26)23-13-15-5-3-9-21-11-15/h1-11H,12-13H2,(H,22,25)(H,23,26).
What are the key properties of 2-N,6-N-bis(pyridin-3-ylmethyl)pyridine-2,6-dicarboxamide?
2-N,6-N-bis(pyridin-3-ylmethyl)pyridine-2,6-dicarboxamide has a molecular weight of 347.38 g/mol, XLogP of 1.73, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,6-N-bis(pyridin-3-ylmethyl)pyridine-2,6-dicarboxamide is sourced from PubChem (CID 4524554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).