C22H29N3O3 — CID 45245881
ethyl 1-(2-methylpyrazole-3-carbonyl)-3-(3-phenylpropyl)piperidine-3-carboxylate (PubChem CID 45245881) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is ethyl 1-(2-methylpyrazole-3-carbonyl)-3-(3-phenylpropyl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-(2-methylpyrazole-3-carbonyl)-3-(3-phenylpropyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 45245881 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | ethyl 1-(2-methylpyrazole-3-carbonyl)-3-(3-phenylpropyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1(CCCc2ccccc2)CCCN(C(=O)c2ccnn2C)C1 |
| InChI | InChI=1S/C22H29N3O3/c1-3-28-21(27)22(13-7-11-18-9-5-4-6-10-18)14-8-16-25(17-22)20(26)19-12-15-23-24(19)2/h4-6,9-10,12,15H,3,7-8,11,13-14,16-17H2,1-2H3 |
| InChIKey | KMNWNDHBRAUGKU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |