C24H26N2O3 — CID 45245905
(2,4-dimethoxyphenyl)-[1-(quinolin-2-ylmethyl)piperidin-3-yl]methanone (PubChem CID 45245905) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)-[1-(quinolin-2-ylmethyl)piperidin-3-yl]methanone.
| Compound Name | (2,4-dimethoxyphenyl)-[1-(quinolin-2-ylmethyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 45245905 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (2,4-dimethoxyphenyl)-[1-(quinolin-2-ylmethyl)piperidin-3-yl]methanone |
| SMILES | COc1ccc(C(=O)C2CCCN(Cc3ccc4ccccc4n3)C2)c(OC)c1 |
| InChI | InChI=1S/C24H26N2O3/c1-28-20-11-12-21(23(14-20)29-2)24(27)18-7-5-13-26(15-18)16-19-10-9-17-6-3-4-8-22(17)25-19/h3-4,6,8-12,14,18H,5,7,13,15-16H2,1-2H3 |
| InChIKey | MJIGMXBWLMCSQL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |