C22H33N3O2 — CID 45246349
N-methyl-4-(2-oxopyrrolidin-1-yl)-N-[1-(2-phenylethyl)piperidin-3-yl]butanamide (PubChem CID 45246349) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-methyl-4-(2-oxopyrrolidin-1-yl)-N-[1-(2-phenylethyl)piperidin-3-yl]butanamide.
| Compound Name | N-methyl-4-(2-oxopyrrolidin-1-yl)-N-[1-(2-phenylethyl)piperidin-3-yl]butanamide |
|---|---|
| PubChem CID | 45246349 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | N-methyl-4-(2-oxopyrrolidin-1-yl)-N-[1-(2-phenylethyl)piperidin-3-yl]butanamide |
| SMILES | CN(C(=O)CCCN1CCCC1=O)C1CCCN(CCc2ccccc2)C1 |
| InChI | InChI=1S/C22H33N3O2/c1-23(21(26)11-6-15-25-16-7-12-22(25)27)20-10-5-14-24(18-20)17-13-19-8-3-2-4-9-19/h2-4,8-9,20H,5-7,10-18H2,1H3 |
| InChIKey | UVYHWJWGFHJWRP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |