About 3-(3-oxo-1,4-benzoxazin-4-yl)propanenitrile
3-(3-oxo-1,4-benzoxazin-4-yl)propanenitrile (PubChem CID 4524659) has the molecular formula C11H10N2O2
and a molecular weight of 202.21 g/mol. Its IUPAC name is 3-(3-oxo-1,4-benzoxazin-4-yl)propanenitrile.
Molecular Properties
| Compound Name | 3-(3-oxo-1,4-benzoxazin-4-yl)propanenitrile |
| PubChem CID | 4524659 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 3-(3-oxo-1,4-benzoxazin-4-yl)propanenitrile |
| SMILES | N#CCCN1C(=O)COc2ccccc21 |
| InChI | InChI=1S/C11H10N2O2/c12-6-3-7-13-9-4-1-2-5-10(9)15-8-11(13)14/h1-2,4-5H,3,7-8H2 |
| InChIKey | CJQMJEYOWARPGD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-oxo-1,4-benzoxazin-4-yl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-oxo-1,4-benzoxazin-4-yl)propanenitrile?
The IUPAC name of 3-(3-oxo-1,4-benzoxazin-4-yl)propanenitrile (CID 4524659) is 3-(3-oxo-1,4-benzoxazin-4-yl)propanenitrile.
What is the SMILES notation for 3-(3-oxo-1,4-benzoxazin-4-yl)propanenitrile?
The canonical SMILES for 3-(3-oxo-1,4-benzoxazin-4-yl)propanenitrile is N#CCCN1C(=O)COc2ccccc21.
What is the InChIKey of 3-(3-oxo-1,4-benzoxazin-4-yl)propanenitrile?
The InChIKey is CJQMJEYOWARPGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2/c12-6-3-7-13-9-4-1-2-5-10(9)15-8-11(13)14/h1-2,4-5H,3,7-8H2.
What are the key properties of 3-(3-oxo-1,4-benzoxazin-4-yl)propanenitrile?
3-(3-oxo-1,4-benzoxazin-4-yl)propanenitrile has a molecular weight of 202.21 g/mol, XLogP of 1.33, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-oxo-1,4-benzoxazin-4-yl)propanenitrile is sourced from PubChem (CID 4524659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).