C17H28N6O3S — CID 45247401
N-(1,1-dioxothiolan-3-yl)-2-[5-[(4-methylpiperidin-1-yl)methyl]tetrazol-1-yl]-N-prop-2-enylacetamide (PubChem CID 45247401) has the molecular formula C17H28N6O3S and a molecular weight of 396.52 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-[5-[(4-methylpiperidin-1-yl)methyl]tetrazol-1-yl]-N-prop-2-enylacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-[5-[(4-methylpiperidin-1-yl)methyl]tetrazol-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 45247401 |
| Molecular Formula | C17H28N6O3S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-[5-[(4-methylpiperidin-1-yl)methyl]tetrazol-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)Cn1nnnc1CN1CCC(C)CC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H28N6O3S/c1-3-7-22(15-6-10-27(25,26)13-15)17(24)12-23-16(18-19-20-23)11-21-8-4-14(2)5-9-21/h3,14-15H,1,4-13H2,2H3 |
| InChIKey | UEBJGFUPGPBRCW-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|