About (2-methylsulfanyl-1,3-thiazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone
(2-methylsulfanyl-1,3-thiazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone (PubChem CID 45247571) has the molecular formula C13H16N4OS2
and a molecular weight of 308.43 g/mol. Its IUPAC name is (2-methylsulfanyl-1,3-thiazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | (2-methylsulfanyl-1,3-thiazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone |
| PubChem CID | 45247571 |
| Molecular Formula | C13H16N4OS2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (2-methylsulfanyl-1,3-thiazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone |
| SMILES | CSc1nc(C(=O)N2CCCC(c3ccn[nH]3)C2)cs1 |
| InChI | InChI=1S/C13H16N4OS2/c1-19-13-15-11(8-20-13)12(18)17-6-2-3-9(7-17)10-4-5-14-16-10/h4-5,8-9H,2-3,6-7H2,1H3,(H,14,16) |
| InChIKey | OELHQWWBWJIMGF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-methylsulfanyl-1,3-thiazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylsulfanyl-1,3-thiazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone?
The IUPAC name of (2-methylsulfanyl-1,3-thiazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone (CID 45247571) is (2-methylsulfanyl-1,3-thiazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone.
What is the SMILES notation for (2-methylsulfanyl-1,3-thiazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone?
The canonical SMILES for (2-methylsulfanyl-1,3-thiazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone is CSc1nc(C(=O)N2CCCC(c3ccn[nH]3)C2)cs1.
What is the InChIKey of (2-methylsulfanyl-1,3-thiazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone?
The InChIKey is OELHQWWBWJIMGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4OS2/c1-19-13-15-11(8-20-13)12(18)17-6-2-3-9(7-17)10-4-5-14-16-10/h4-5,8-9H,2-3,6-7H2,1H3,(H,14,16).
What are the key properties of (2-methylsulfanyl-1,3-thiazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone?
(2-methylsulfanyl-1,3-thiazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone has a molecular weight of 308.43 g/mol, XLogP of 2.61, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylsulfanyl-1,3-thiazol-4-yl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone is sourced from PubChem (CID 45247571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).