C17H20N4O — CID 45247859
5-cyclohex-3-en-1-yl-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole (PubChem CID 45247859) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 5-cyclohex-3-en-1-yl-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole.
| Compound Name | 5-cyclohex-3-en-1-yl-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 45247859 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 5-cyclohex-3-en-1-yl-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole |
| SMILES | Cc1ncc2c(c1-c1noc(C3CC=CCC3)n1)CCNC2 |
| InChI | InChI=1S/C17H20N4O/c1-11-15(14-7-8-18-9-13(14)10-19-11)16-20-17(22-21-16)12-5-3-2-4-6-12/h2-3,10,12,18H,4-9H2,1H3 |
| InChIKey | SPGZNTQLNMQCSB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|