C22H33N3O4 — CID 45248118
1-[2-methoxy-4-[(2-pyridin-3-yloxyethylamino)methyl]phenoxy]-3-[methyl(propan-2-yl)amino]propan-2-ol (PubChem CID 45248118) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is 1-[2-methoxy-4-[(2-pyridin-3-yloxyethylamino)methyl]phenoxy]-3-[methyl(propan-2-yl)amino]propan-2-ol.
| Compound Name | 1-[2-methoxy-4-[(2-pyridin-3-yloxyethylamino)methyl]phenoxy]-3-[methyl(propan-2-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 45248118 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 1-[2-methoxy-4-[(2-pyridin-3-yloxyethylamino)methyl]phenoxy]-3-[methyl(propan-2-yl)amino]propan-2-ol |
| SMILES | COc1cc(CNCCOc2cccnc2)ccc1OCC(O)CN(C)C(C)C |
| InChI | InChI=1S/C22H33N3O4/c1-17(2)25(3)15-19(26)16-29-21-8-7-18(12-22(21)27-4)13-24-10-11-28-20-6-5-9-23-14-20/h5-9,12,14,17,19,24,26H,10-11,13,15-16H2,1-4H3 |
| InChIKey | HPAIFBFUQNMKBN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 76.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|