C23H22N2O3 — CID 45248662
1,3-benzodioxol-5-yl-[1-(isoquinolin-5-ylmethyl)piperidin-3-yl]methanone (PubChem CID 45248662) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[1-(isoquinolin-5-ylmethyl)piperidin-3-yl]methanone.
| Compound Name | 1,3-benzodioxol-5-yl-[1-(isoquinolin-5-ylmethyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 45248662 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[1-(isoquinolin-5-ylmethyl)piperidin-3-yl]methanone |
| SMILES | O=C(c1ccc2c(c1)OCO2)C1CCCN(Cc2cccc3cnccc23)C1 |
| InChI | InChI=1S/C23H22N2O3/c26-23(16-6-7-21-22(11-16)28-15-27-21)19-5-2-10-25(14-19)13-18-4-1-3-17-12-24-9-8-20(17)18/h1,3-4,6-9,11-12,19H,2,5,10,13-15H2 |
| InChIKey | FVXLGQXTXCJFGL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |