About 6-[9-(2,2-dimethylpropyl)-2,9-diazaspiro[4.5]decane-2-carbonyl]-2-methylpyridazin-3-one
6-[9-(2,2-dimethylpropyl)-2,9-diazaspiro[4.5]decane-2-carbonyl]-2-methylpyridazin-3-one (PubChem CID 45249302) has the molecular formula C19H30N4O2
and a molecular weight of 346.48 g/mol. Its IUPAC name is 6-[9-(2,2-dimethylpropyl)-2,9-diazaspiro[4.5]decane-2-carbonyl]-2-methylpyridazin-3-one.
Molecular Properties
| Compound Name | 6-[9-(2,2-dimethylpropyl)-2,9-diazaspiro[4.5]decane-2-carbonyl]-2-methylpyridazin-3-one |
| PubChem CID | 45249302 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 6-[9-(2,2-dimethylpropyl)-2,9-diazaspiro[4.5]decane-2-carbonyl]-2-methylpyridazin-3-one |
| SMILES | Cn1nc(C(=O)N2CCC3(CCCN(CC(C)(C)C)C3)C2)ccc1=O |
| InChI | InChI=1S/C19H30N4O2/c1-18(2,3)12-22-10-5-8-19(13-22)9-11-23(14-19)17(25)15-6-7-16(24)21(4)20-15/h6-7H,5,8-14H2,1-4H3 |
| InChIKey | AFCGZXGNMRHQSE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[9-(2,2-dimethylpropyl)-2,9-diazaspiro[4.5]decane-2-carbonyl]-2-methylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[9-(2,2-dimethylpropyl)-2,9-diazaspiro[4.5]decane-2-carbonyl]-2-methylpyridazin-3-one?
The IUPAC name of 6-[9-(2,2-dimethylpropyl)-2,9-diazaspiro[4.5]decane-2-carbonyl]-2-methylpyridazin-3-one (CID 45249302) is 6-[9-(2,2-dimethylpropyl)-2,9-diazaspiro[4.5]decane-2-carbonyl]-2-methylpyridazin-3-one.
What is the SMILES notation for 6-[9-(2,2-dimethylpropyl)-2,9-diazaspiro[4.5]decane-2-carbonyl]-2-methylpyridazin-3-one?
The canonical SMILES for 6-[9-(2,2-dimethylpropyl)-2,9-diazaspiro[4.5]decane-2-carbonyl]-2-methylpyridazin-3-one is Cn1nc(C(=O)N2CCC3(CCCN(CC(C)(C)C)C3)C2)ccc1=O.
What is the InChIKey of 6-[9-(2,2-dimethylpropyl)-2,9-diazaspiro[4.5]decane-2-carbonyl]-2-methylpyridazin-3-one?
The InChIKey is AFCGZXGNMRHQSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N4O2/c1-18(2,3)12-22-10-5-8-19(13-22)9-11-23(14-19)17(25)15-6-7-16(24)21(4)20-15/h6-7H,5,8-14H2,1-4H3.
What are the key properties of 6-[9-(2,2-dimethylpropyl)-2,9-diazaspiro[4.5]decane-2-carbonyl]-2-methylpyridazin-3-one?
6-[9-(2,2-dimethylpropyl)-2,9-diazaspiro[4.5]decane-2-carbonyl]-2-methylpyridazin-3-one has a molecular weight of 346.48 g/mol, XLogP of 1.75, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[9-(2,2-dimethylpropyl)-2,9-diazaspiro[4.5]decane-2-carbonyl]-2-methylpyridazin-3-one is sourced from PubChem (CID 45249302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).