About (1,1-dioxo-1,4-thiazinan-4-yl)-[5-[1-(3-methylbutyl)pyrrolidin-2-yl]thiophen-2-yl]methanone
(1,1-dioxo-1,4-thiazinan-4-yl)-[5-[1-(3-methylbutyl)pyrrolidin-2-yl]thiophen-2-yl]methanone (PubChem CID 45249650) has the molecular formula C18H28N2O3S2
and a molecular weight of 384.57 g/mol. Its IUPAC name is (1,1-dioxo-1,4-thiazinan-4-yl)-[5-[1-(3-methylbutyl)pyrrolidin-2-yl]thiophen-2-yl]methanone.
Molecular Properties
| Compound Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[5-[1-(3-methylbutyl)pyrrolidin-2-yl]thiophen-2-yl]methanone |
| PubChem CID | 45249650 |
| Molecular Formula | C18H28N2O3S2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[5-[1-(3-methylbutyl)pyrrolidin-2-yl]thiophen-2-yl]methanone |
| SMILES | CC(C)CCN1CCCC1c1ccc(C(=O)N2CCS(=O)(=O)CC2)s1 |
| InChI | InChI=1S/C18H28N2O3S2/c1-14(2)7-9-19-8-3-4-15(19)16-5-6-17(24-16)18(21)20-10-12-25(22,23)13-11-20/h5-6,14-15H,3-4,7-13H2,1-2H3 |
| InChIKey | CIMVBRLBGAAONU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1,1-dioxo-1,4-thiazinan-4-yl)-[5-[1-(3-methylbutyl)pyrrolidin-2-yl]thiophen-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,1-dioxo-1,4-thiazinan-4-yl)-[5-[1-(3-methylbutyl)pyrrolidin-2-yl]thiophen-2-yl]methanone?
The IUPAC name of (1,1-dioxo-1,4-thiazinan-4-yl)-[5-[1-(3-methylbutyl)pyrrolidin-2-yl]thiophen-2-yl]methanone (CID 45249650) is (1,1-dioxo-1,4-thiazinan-4-yl)-[5-[1-(3-methylbutyl)pyrrolidin-2-yl]thiophen-2-yl]methanone.
What is the SMILES notation for (1,1-dioxo-1,4-thiazinan-4-yl)-[5-[1-(3-methylbutyl)pyrrolidin-2-yl]thiophen-2-yl]methanone?
The canonical SMILES for (1,1-dioxo-1,4-thiazinan-4-yl)-[5-[1-(3-methylbutyl)pyrrolidin-2-yl]thiophen-2-yl]methanone is CC(C)CCN1CCCC1c1ccc(C(=O)N2CCS(=O)(=O)CC2)s1.
What is the InChIKey of (1,1-dioxo-1,4-thiazinan-4-yl)-[5-[1-(3-methylbutyl)pyrrolidin-2-yl]thiophen-2-yl]methanone?
The InChIKey is CIMVBRLBGAAONU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O3S2/c1-14(2)7-9-19-8-3-4-15(19)16-5-6-17(24-16)18(21)20-10-12-25(22,23)13-11-20/h5-6,14-15H,3-4,7-13H2,1-2H3.
What are the key properties of (1,1-dioxo-1,4-thiazinan-4-yl)-[5-[1-(3-methylbutyl)pyrrolidin-2-yl]thiophen-2-yl]methanone?
(1,1-dioxo-1,4-thiazinan-4-yl)-[5-[1-(3-methylbutyl)pyrrolidin-2-yl]thiophen-2-yl]methanone has a molecular weight of 384.57 g/mol, XLogP of 2.80, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1-dioxo-1,4-thiazinan-4-yl)-[5-[1-(3-methylbutyl)pyrrolidin-2-yl]thiophen-2-yl]methanone is sourced from PubChem (CID 45249650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).