C16H24N6OS — CID 45249682
[1-[[1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]methyl]triazol-4-yl]methylurea (PubChem CID 45249682) has the molecular formula C16H24N6OS and a molecular weight of 348.48 g/mol. Its IUPAC name is [1-[[1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]methyl]triazol-4-yl]methylurea.
| Compound Name | [1-[[1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]methyl]triazol-4-yl]methylurea |
|---|---|
| PubChem CID | 45249682 |
| Molecular Formula | C16H24N6OS |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | [1-[[1-[(5-methylthiophen-2-yl)methyl]piperidin-3-yl]methyl]triazol-4-yl]methylurea |
| SMILES | Cc1ccc(CN2CCCC(Cn3cc(CNC(N)=O)nn3)C2)s1 |
| InChI | InChI=1S/C16H24N6OS/c1-12-4-5-15(24-12)11-21-6-2-3-13(8-21)9-22-10-14(19-20-22)7-18-16(17)23/h4-5,10,13H,2-3,6-9,11H2,1H3,(H3,17,18,23) |
| InChIKey | FLVIAVDBPKYHGH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |