C27H28N4O2 — CID 45249830
5-[(4-benzhydrylpiperazin-1-yl)methyl]-3-(phenoxymethyl)-1,2,4-oxadiazole (PubChem CID 45249830) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 5-[(4-benzhydrylpiperazin-1-yl)methyl]-3-(phenoxymethyl)-1,2,4-oxadiazole.
| Compound Name | 5-[(4-benzhydrylpiperazin-1-yl)methyl]-3-(phenoxymethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 45249830 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 5-[(4-benzhydrylpiperazin-1-yl)methyl]-3-(phenoxymethyl)-1,2,4-oxadiazole |
| SMILES | c1ccc(OCc2noc(CN3CCN(C(c4ccccc4)c4ccccc4)CC3)n2)cc1 |
| InChI | InChI=1S/C27H28N4O2/c1-4-10-22(11-5-1)27(23-12-6-2-7-13-23)31-18-16-30(17-19-31)20-26-28-25(29-33-26)21-32-24-14-8-3-9-15-24/h1-15,27H,16-21H2 |
| InChIKey | FVSOMBDNJIKHPC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 54.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |