About (2-amino-4-methyl-1,3-thiazol-5-yl)-[3-[(4-propyltriazol-1-yl)methyl]piperidin-1-yl]methanone
(2-amino-4-methyl-1,3-thiazol-5-yl)-[3-[(4-propyltriazol-1-yl)methyl]piperidin-1-yl]methanone (PubChem CID 45250773) has the molecular formula C16H24N6OS
and a molecular weight of 348.48 g/mol. Its IUPAC name is (2-amino-4-methyl-1,3-thiazol-5-yl)-[3-[(4-propyltriazol-1-yl)methyl]piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | (2-amino-4-methyl-1,3-thiazol-5-yl)-[3-[(4-propyltriazol-1-yl)methyl]piperidin-1-yl]methanone |
| PubChem CID | 45250773 |
| Molecular Formula | C16H24N6OS |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (2-amino-4-methyl-1,3-thiazol-5-yl)-[3-[(4-propyltriazol-1-yl)methyl]piperidin-1-yl]methanone |
| SMILES | CCCc1cn(CC2CCCN(C(=O)c3sc(N)nc3C)C2)nn1 |
| InChI | InChI=1S/C16H24N6OS/c1-3-5-13-10-22(20-19-13)9-12-6-4-7-21(8-12)15(23)14-11(2)18-16(17)24-14/h10,12H,3-9H2,1-2H3,(H2,17,18) |
| InChIKey | ISFYHQIPWBHKIW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2-amino-4-methyl-1,3-thiazol-5-yl)-[3-[(4-propyltriazol-1-yl)methyl]piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-4-methyl-1,3-thiazol-5-yl)-[3-[(4-propyltriazol-1-yl)methyl]piperidin-1-yl]methanone?
The IUPAC name of (2-amino-4-methyl-1,3-thiazol-5-yl)-[3-[(4-propyltriazol-1-yl)methyl]piperidin-1-yl]methanone (CID 45250773) is (2-amino-4-methyl-1,3-thiazol-5-yl)-[3-[(4-propyltriazol-1-yl)methyl]piperidin-1-yl]methanone.
What is the SMILES notation for (2-amino-4-methyl-1,3-thiazol-5-yl)-[3-[(4-propyltriazol-1-yl)methyl]piperidin-1-yl]methanone?
The canonical SMILES for (2-amino-4-methyl-1,3-thiazol-5-yl)-[3-[(4-propyltriazol-1-yl)methyl]piperidin-1-yl]methanone is CCCc1cn(CC2CCCN(C(=O)c3sc(N)nc3C)C2)nn1.
What is the InChIKey of (2-amino-4-methyl-1,3-thiazol-5-yl)-[3-[(4-propyltriazol-1-yl)methyl]piperidin-1-yl]methanone?
The InChIKey is ISFYHQIPWBHKIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N6OS/c1-3-5-13-10-22(20-19-13)9-12-6-4-7-21(8-12)15(23)14-11(2)18-16(17)24-14/h10,12H,3-9H2,1-2H3,(H2,17,18).
What are the key properties of (2-amino-4-methyl-1,3-thiazol-5-yl)-[3-[(4-propyltriazol-1-yl)methyl]piperidin-1-yl]methanone?
(2-amino-4-methyl-1,3-thiazol-5-yl)-[3-[(4-propyltriazol-1-yl)methyl]piperidin-1-yl]methanone has a molecular weight of 348.48 g/mol, XLogP of 2.13, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-4-methyl-1,3-thiazol-5-yl)-[3-[(4-propyltriazol-1-yl)methyl]piperidin-1-yl]methanone is sourced from PubChem (CID 45250773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).