C20H28ClN3O2 — CID 45251148
N-[2-[4-[1-[(4-chlorophenyl)methyl]pyrrolidin-3-yl]piperidin-1-yl]-2-oxoethyl]acetamide (PubChem CID 45251148) has the molecular formula C20H28ClN3O2 and a molecular weight of 377.92 g/mol. Its IUPAC name is N-[2-[4-[1-[(4-chlorophenyl)methyl]pyrrolidin-3-yl]piperidin-1-yl]-2-oxoethyl]acetamide.
| Compound Name | N-[2-[4-[1-[(4-chlorophenyl)methyl]pyrrolidin-3-yl]piperidin-1-yl]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 45251148 |
| Molecular Formula | C20H28ClN3O2 |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-[2-[4-[1-[(4-chlorophenyl)methyl]pyrrolidin-3-yl]piperidin-1-yl]-2-oxoethyl]acetamide |
| SMILES | CC(=O)NCC(=O)N1CCC(C2CCN(Cc3ccc(Cl)cc3)C2)CC1 |
| InChI | InChI=1S/C20H28ClN3O2/c1-15(25)22-12-20(26)24-10-7-17(8-11-24)18-6-9-23(14-18)13-16-2-4-19(21)5-3-16/h2-5,17-18H,6-14H2,1H3,(H,22,25) |
| InChIKey | NQRXMBBVGIDZGU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |