C23H23FN2O3 — CID 45251564
1-[7-[(4-fluorophenyl)methyl]-6-oxo-2,7-diazaspiro[4.5]decan-2-yl]-2-phenylethane-1,2-dione (PubChem CID 45251564) has the molecular formula C23H23FN2O3 and a molecular weight of 394.45 g/mol. Its IUPAC name is 1-[7-[(4-fluorophenyl)methyl]-6-oxo-2,7-diazaspiro[4.5]decan-2-yl]-2-phenylethane-1,2-dione.
| Compound Name | 1-[7-[(4-fluorophenyl)methyl]-6-oxo-2,7-diazaspiro[4.5]decan-2-yl]-2-phenylethane-1,2-dione |
|---|---|
| PubChem CID | 45251564 |
| Molecular Formula | C23H23FN2O3 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 1-[7-[(4-fluorophenyl)methyl]-6-oxo-2,7-diazaspiro[4.5]decan-2-yl]-2-phenylethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCC2(CCCN(Cc3ccc(F)cc3)C2=O)C1)c1ccccc1 |
| InChI | InChI=1S/C23H23FN2O3/c24-19-9-7-17(8-10-19)15-25-13-4-11-23(22(25)29)12-14-26(16-23)21(28)20(27)18-5-2-1-3-6-18/h1-3,5-10H,4,11-16H2 |
| InChIKey | VMEGUHIZJGFRLS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|