C20H21N3O4 — CID 45251660
N-(oxan-2-ylmethyl)-2-(quinolin-8-yloxymethyl)-1,3-oxazole-4-carboxamide (PubChem CID 45251660) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-(oxan-2-ylmethyl)-2-(quinolin-8-yloxymethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-(oxan-2-ylmethyl)-2-(quinolin-8-yloxymethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 45251660 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-(oxan-2-ylmethyl)-2-(quinolin-8-yloxymethyl)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCC1CCCCO1)c1coc(COc2cccc3cccnc23)n1 |
| InChI | InChI=1S/C20H21N3O4/c24-20(22-11-15-7-1-2-10-25-15)16-12-27-18(23-16)13-26-17-8-3-5-14-6-4-9-21-19(14)17/h3-6,8-9,12,15H,1-2,7,10-11,13H2,(H,22,24) |
| InChIKey | UBRUGRLHQGRXDP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |