About [3-[(2,4-difluorophenyl)methyl]-1-[(4-ethylphenyl)methyl]piperidin-3-yl]methanol
[3-[(2,4-difluorophenyl)methyl]-1-[(4-ethylphenyl)methyl]piperidin-3-yl]methanol (PubChem CID 45251706) has the molecular formula C22H27F2NO
and a molecular weight of 359.46 g/mol. Its IUPAC name is [3-[(2,4-difluorophenyl)methyl]-1-[(4-ethylphenyl)methyl]piperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [3-[(2,4-difluorophenyl)methyl]-1-[(4-ethylphenyl)methyl]piperidin-3-yl]methanol |
| PubChem CID | 45251706 |
| Molecular Formula | C22H27F2NO |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | [3-[(2,4-difluorophenyl)methyl]-1-[(4-ethylphenyl)methyl]piperidin-3-yl]methanol |
| SMILES | CCc1ccc(CN2CCCC(CO)(Cc3ccc(F)cc3F)C2)cc1 |
| InChI | InChI=1S/C22H27F2NO/c1-2-17-4-6-18(7-5-17)14-25-11-3-10-22(15-25,16-26)13-19-8-9-20(23)12-21(19)24/h4-9,12,26H,2-3,10-11,13-16H2,1H3 |
| InChIKey | FDAAPVLQGHOBEH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-[(2,4-difluorophenyl)methyl]-1-[(4-ethylphenyl)methyl]piperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2,4-difluorophenyl)methyl]-1-[(4-ethylphenyl)methyl]piperidin-3-yl]methanol?
The IUPAC name of [3-[(2,4-difluorophenyl)methyl]-1-[(4-ethylphenyl)methyl]piperidin-3-yl]methanol (CID 45251706) is [3-[(2,4-difluorophenyl)methyl]-1-[(4-ethylphenyl)methyl]piperidin-3-yl]methanol.
What is the SMILES notation for [3-[(2,4-difluorophenyl)methyl]-1-[(4-ethylphenyl)methyl]piperidin-3-yl]methanol?
The canonical SMILES for [3-[(2,4-difluorophenyl)methyl]-1-[(4-ethylphenyl)methyl]piperidin-3-yl]methanol is CCc1ccc(CN2CCCC(CO)(Cc3ccc(F)cc3F)C2)cc1.
What is the InChIKey of [3-[(2,4-difluorophenyl)methyl]-1-[(4-ethylphenyl)methyl]piperidin-3-yl]methanol?
The InChIKey is FDAAPVLQGHOBEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27F2NO/c1-2-17-4-6-18(7-5-17)14-25-11-3-10-22(15-25,16-26)13-19-8-9-20(23)12-21(19)24/h4-9,12,26H,2-3,10-11,13-16H2,1H3.
What are the key properties of [3-[(2,4-difluorophenyl)methyl]-1-[(4-ethylphenyl)methyl]piperidin-3-yl]methanol?
[3-[(2,4-difluorophenyl)methyl]-1-[(4-ethylphenyl)methyl]piperidin-3-yl]methanol has a molecular weight of 359.46 g/mol, XLogP of 4.34, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2,4-difluorophenyl)methyl]-1-[(4-ethylphenyl)methyl]piperidin-3-yl]methanol is sourced from PubChem (CID 45251706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).