About 4-[3-[1-(pyrrolidin-3-ylmethyl)pyrazol-3-yl]phenyl]thieno[2,3-d]pyrimidine
4-[3-[1-(pyrrolidin-3-ylmethyl)pyrazol-3-yl]phenyl]thieno[2,3-d]pyrimidine (PubChem CID 45253118) has the molecular formula C20H19N5S
and a molecular weight of 361.47 g/mol. Its IUPAC name is 4-[3-[1-(pyrrolidin-3-ylmethyl)pyrazol-3-yl]phenyl]thieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-[3-[1-(pyrrolidin-3-ylmethyl)pyrazol-3-yl]phenyl]thieno[2,3-d]pyrimidine |
| PubChem CID | 45253118 |
| Molecular Formula | C20H19N5S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 4-[3-[1-(pyrrolidin-3-ylmethyl)pyrazol-3-yl]phenyl]thieno[2,3-d]pyrimidine |
| SMILES | c1cc(-c2ccn(CC3CCNC3)n2)cc(-c2ncnc3sccc23)c1 |
| InChI | InChI=1S/C20H19N5S/c1-2-15(18-5-8-25(24-18)12-14-4-7-21-11-14)10-16(3-1)19-17-6-9-26-20(17)23-13-22-19/h1-3,5-6,8-10,13-14,21H,4,7,11-12H2 |
| InChIKey | FFOLNULGTIPMSS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[3-[1-(pyrrolidin-3-ylmethyl)pyrazol-3-yl]phenyl]thieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[1-(pyrrolidin-3-ylmethyl)pyrazol-3-yl]phenyl]thieno[2,3-d]pyrimidine?
The IUPAC name of 4-[3-[1-(pyrrolidin-3-ylmethyl)pyrazol-3-yl]phenyl]thieno[2,3-d]pyrimidine (CID 45253118) is 4-[3-[1-(pyrrolidin-3-ylmethyl)pyrazol-3-yl]phenyl]thieno[2,3-d]pyrimidine.
What is the SMILES notation for 4-[3-[1-(pyrrolidin-3-ylmethyl)pyrazol-3-yl]phenyl]thieno[2,3-d]pyrimidine?
The canonical SMILES for 4-[3-[1-(pyrrolidin-3-ylmethyl)pyrazol-3-yl]phenyl]thieno[2,3-d]pyrimidine is c1cc(-c2ccn(CC3CCNC3)n2)cc(-c2ncnc3sccc23)c1.
What is the InChIKey of 4-[3-[1-(pyrrolidin-3-ylmethyl)pyrazol-3-yl]phenyl]thieno[2,3-d]pyrimidine?
The InChIKey is FFOLNULGTIPMSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N5S/c1-2-15(18-5-8-25(24-18)12-14-4-7-21-11-14)10-16(3-1)19-17-6-9-26-20(17)23-13-22-19/h1-3,5-6,8-10,13-14,21H,4,7,11-12H2.
What are the key properties of 4-[3-[1-(pyrrolidin-3-ylmethyl)pyrazol-3-yl]phenyl]thieno[2,3-d]pyrimidine?
4-[3-[1-(pyrrolidin-3-ylmethyl)pyrazol-3-yl]phenyl]thieno[2,3-d]pyrimidine has a molecular weight of 361.47 g/mol, XLogP of 3.83, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[1-(pyrrolidin-3-ylmethyl)pyrazol-3-yl]phenyl]thieno[2,3-d]pyrimidine is sourced from PubChem (CID 45253118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).