C29H19N5O5 — CID 45253893
2-amino-N-[(E)-[4-(5,7,12,14-tetraoxo-13-phenyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)phenyl]methylideneamino]acetamide (PubChem CID 45253893) has the molecular formula C29H19N5O5 and a molecular weight of 517.50 g/mol. Its IUPAC name is 2-amino-N-[(E)-[4-(5,7,12,14-tetraoxo-13-phenyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)phenyl]methylideneamino]acetamide.
| Compound Name | 2-amino-N-[(E)-[4-(5,7,12,14-tetraoxo-13-phenyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 45253893 |
| Molecular Formula | C29H19N5O5 |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | 2-amino-N-[(E)-[4-(5,7,12,14-tetraoxo-13-phenyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)phenyl]methylideneamino]acetamide |
| SMILES | NCC(=O)N/N=C/c1ccc(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(c2ccccc2)C4=O)cc1 |
| InChI | InChI=1S/C29H19N5O5/c30-14-23(35)32-31-15-16-6-8-18(9-7-16)34-28(38)21-12-10-19-24-20(11-13-22(25(21)24)29(34)39)27(37)33(26(19)36)17-4-2-1-3-5-17/h1-13,15H,14,30H2,(H,32,35)/b31-15+ |
| InChIKey | RKDHYCAJGLMFHI-IBBHUPRXSA-N |
| XLogP | 2.85 |
| TPSA | 142.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|