C29H20N5O5+ — CID 45253900
[2-oxo-2-[(2E)-2-[[4-(5,7,12,14-tetraoxo-13-phenyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)phenyl]methylidene]hydrazinyl]ethyl]azanium (PubChem CID 45253900) has the molecular formula C29H20N5O5+ and a molecular weight of 518.51 g/mol. Its IUPAC name is [2-oxo-2-[(2E)-2-[[4-(5,7,12,14-tetraoxo-13-phenyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)phenyl]methylidene]hydrazinyl]ethyl]azanium.
| Compound Name | [2-oxo-2-[(2E)-2-[[4-(5,7,12,14-tetraoxo-13-phenyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)phenyl]methylidene]hydrazinyl]ethyl]azanium |
|---|---|
| PubChem CID | 45253900 |
| Molecular Formula | C29H20N5O5+ |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | [2-oxo-2-[(2E)-2-[[4-(5,7,12,14-tetraoxo-13-phenyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)phenyl]methylidene]hydrazinyl]ethyl]azanium |
| SMILES | [NH3+]CC(=O)N/N=C/c1ccc(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(c2ccccc2)C4=O)cc1 |
| InChI | InChI=1S/C29H19N5O5/c30-14-23(35)32-31-15-16-6-8-18(9-7-16)34-28(38)21-12-10-19-24-20(11-13-22(25(21)24)29(34)39)27(37)33(26(19)36)17-4-2-1-3-5-17/h1-13,15H,14,30H2,(H,32,35)/p+1/b31-15+ |
| InChIKey | RKDHYCAJGLMFHI-IBBHUPRXSA-O |
| XLogP | 2.13 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|