C33H20N4O7S — CID 45253904
4-[(2E)-2-[[4-(5,7,12,14-tetraoxo-13-phenyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)phenyl]methylidene]hydrazinyl]benzenesulfonic acid (PubChem CID 45253904) has the molecular formula C33H20N4O7S and a molecular weight of 616.61 g/mol. Its IUPAC name is 4-[(2E)-2-[[4-(5,7,12,14-tetraoxo-13-phenyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)phenyl]methylidene]hydrazinyl]benzenesulfonic acid.
| Compound Name | 4-[(2E)-2-[[4-(5,7,12,14-tetraoxo-13-phenyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)phenyl]methylidene]hydrazinyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 45253904 |
| Molecular Formula | C33H20N4O7S |
| Molecular Weight | 616.61 g/mol |
| Exact Mass | 616.11 |
| IUPAC Name | 4-[(2E)-2-[[4-(5,7,12,14-tetraoxo-13-phenyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)phenyl]methylidene]hydrazinyl]benzenesulfonic acid |
| SMILES | O=C1c2ccc3c4c(ccc(c24)C(=O)N1c1ccccc1)C(=O)N(c1ccc(/C=N/Nc2ccc(S(=O)(=O)O)cc2)cc1)C3=O |
| InChI | InChI=1S/C33H20N4O7S/c38-30-24-14-16-26-29-27(17-15-25(28(24)29)31(39)36(30)21-4-2-1-3-5-21)33(41)37(32(26)40)22-10-6-19(7-11-22)18-34-35-20-8-12-23(13-9-20)45(42,43)44/h1-18,35H,(H,42,43,44)/b34-18+ |
| InChIKey | LGNHILWDBXNIGW-FABQOPTDSA-N |
| XLogP | 5.13 |
| TPSA | 153.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.61 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|