C19H38N5O5+ — CID 45254013
[(5S)-5-[[(2S,3R)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-3-hydroxybutanoyl]amino]-6-oxohexyl]-trimethylazanium (PubChem CID 45254013) has the molecular formula C19H38N5O5+ and a molecular weight of 416.54 g/mol. Its IUPAC name is [(5S)-5-[[(2S,3R)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-3-hydroxybutanoyl]amino]-6-oxohexyl]-trimethylazanium.
| Compound Name | [(5S)-5-[[(2S,3R)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-3-hydroxybutanoyl]amino]-6-oxohexyl]-trimethylazanium |
|---|---|
| PubChem CID | 45254013 |
| Molecular Formula | C19H38N5O5+ |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | [(5S)-5-[[(2S,3R)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-3-hydroxybutanoyl]amino]-6-oxohexyl]-trimethylazanium |
| SMILES | C[C@H](N)C(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N[C@H](C=O)CCCC[N+](C)(C)C)[C@@H](C)O |
| InChI | InChI=1S/C19H37N5O5/c1-12(20)17(27)21-13(2)18(28)23-16(14(3)26)19(29)22-15(11-25)9-7-8-10-24(4,5)6/h11-16,26H,7-10,20H2,1-6H3,(H2-,21,22,23,27,28,29)/p+1/t12-,13-,14+,15-,16-/m0/s1 |
| InChIKey | CCHCGHUVVATGKP-QMHWVQJVSA-O |
| XLogP | -1.74 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|