C22H33NO3 — CID 45254339
cyclohexyl (4aR,8S,8aR)-2-cyclohexyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylate (PubChem CID 45254339) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is cyclohexyl (4aR,8S,8aR)-2-cyclohexyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylate.
| Compound Name | cyclohexyl (4aR,8S,8aR)-2-cyclohexyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylate |
|---|---|
| PubChem CID | 45254339 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | cyclohexyl (4aR,8S,8aR)-2-cyclohexyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylate |
| SMILES | O=C(OC1CCCCC1)[C@H]1CC=C[C@H]2CCN(C3CCCCC3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C22H33NO3/c24-21-20-16(14-15-23(21)17-9-3-1-4-10-17)8-7-13-19(20)22(25)26-18-11-5-2-6-12-18/h7-8,16-20H,1-6,9-15H2/t16-,19-,20+/m0/s1 |
| InChIKey | WVKPBNSOIUTLDZ-FFZOFVMBSA-N |
| XLogP | 4.24 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|