C21H25N3O2S — CID 45254471
1,1,2,2-tetradeuterio-2-[2-[2,2,3,3,5,5-hexadeuterio-4-(1,2,3,4,7,8,9,10-octadeuteriobenzo[b][1,4]benzothiazepin-6-yl)piperazin-1-yl]ethoxy]ethanol (PubChem CID 45254471) has the molecular formula C21H25N3O2S and a molecular weight of 401.63 g/mol. Its IUPAC name is 1,1,2,2-tetradeuterio-2-[2-[2,2,3,3,5,5-hexadeuterio-4-(1,2,3,4,7,8,9,10-octadeuteriobenzo[b][1,4]benzothiazepin-6-yl)piperazin-1-yl]ethoxy]ethanol.
| Compound Name | 1,1,2,2-tetradeuterio-2-[2-[2,2,3,3,5,5-hexadeuterio-4-(1,2,3,4,7,8,9,10-octadeuteriobenzo[b][1,4]benzothiazepin-6-yl)piperazin-1-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 45254471 |
| Molecular Formula | C21H25N3O2S |
| Molecular Weight | 401.63 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | 1,1,2,2-tetradeuterio-2-[2-[2,2,3,3,5,5-hexadeuterio-4-(1,2,3,4,7,8,9,10-octadeuteriobenzo[b][1,4]benzothiazepin-6-yl)piperazin-1-yl]ethoxy]ethanol |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])N=C(N1C([2H])([2H])CN(CCOC([2H])([2H])C([2H])([2H])O)C([2H])([2H])C1([2H])[2H])c1c([2H])c([2H])c([2H])c([2H])c1S2 |
| InChI | InChI=1S/C21H25N3O2S/c25-14-16-26-15-13-23-9-11-24(12-10-23)21-17-5-1-3-7-19(17)27-20-8-4-2-6-18(20)22-21/h1-8,25H,9-16H2/i1D,2D,3D,4D,5D,6D,7D,8D,9D2,11D2,12D2,14D2,16D2 |
| InChIKey | URKOMYMAXPYINW-HPJDBHJYSA-N |
| XLogP | 2.86 |
| TPSA | 48.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.63 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |