C20H25NO4 — CID 45254637
(2S,3S)-N,3-dihydroxy-2,4-dimethyl-2-[(4-phenylphenyl)methoxy]pentanamide (PubChem CID 45254637) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is (2S,3S)-N,3-dihydroxy-2,4-dimethyl-2-[(4-phenylphenyl)methoxy]pentanamide.
| Compound Name | (2S,3S)-N,3-dihydroxy-2,4-dimethyl-2-[(4-phenylphenyl)methoxy]pentanamide |
|---|---|
| PubChem CID | 45254637 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (2S,3S)-N,3-dihydroxy-2,4-dimethyl-2-[(4-phenylphenyl)methoxy]pentanamide |
| SMILES | CC(C)[C@H](O)[C@](C)(OCc1ccc(-c2ccccc2)cc1)C(=O)NO |
| InChI | InChI=1S/C20H25NO4/c1-14(2)18(22)20(3,19(23)21-24)25-13-15-9-11-17(12-10-15)16-7-5-4-6-8-16/h4-12,14,18,22,24H,13H2,1-3H3,(H,21,23)/t18-,20-/m0/s1 |
| InChIKey | OEIHVBMZXNURRL-ICSRJNTNSA-N |
| XLogP | 3.15 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|