C18H23NO5 — CID 45254643
(3aS,4R,8R,8aR,8bS)-8-hydroxy-2,2-dimethyl-4-(phenylmethoxymethyl)-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-6-one (PubChem CID 45254643) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is (3aS,4R,8R,8aR,8bS)-8-hydroxy-2,2-dimethyl-4-(phenylmethoxymethyl)-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-6-one.
| Compound Name | (3aS,4R,8R,8aR,8bS)-8-hydroxy-2,2-dimethyl-4-(phenylmethoxymethyl)-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-6-one |
|---|---|
| PubChem CID | 45254643 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (3aS,4R,8R,8aR,8bS)-8-hydroxy-2,2-dimethyl-4-(phenylmethoxymethyl)-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-6-one |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@@H](COCc1ccccc1)N1C(=O)C[C@@H](O)[C@H]21 |
| InChI | InChI=1S/C18H23NO5/c1-18(2)23-16-12(10-22-9-11-6-4-3-5-7-11)19-14(21)8-13(20)15(19)17(16)24-18/h3-7,12-13,15-17,20H,8-10H2,1-2H3/t12-,13-,15-,16+,17+/m1/s1 |
| InChIKey | FDGIUBJUMRYHPS-ZLVKTETGSA-N |
| XLogP | 1.07 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |