C15H31ClN2 — CID 45254800
(3S,4R)-3-butyl-1-cyclohexylpiperidin-4-amine;hydrochloride (PubChem CID 45254800) has the molecular formula C15H31ClN2 and a molecular weight of 274.88 g/mol. Its IUPAC name is (3S,4R)-3-butyl-1-cyclohexylpiperidin-4-amine;hydrochloride.
| Compound Name | (3S,4R)-3-butyl-1-cyclohexylpiperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 45254800 |
| Molecular Formula | C15H31ClN2 |
| Molecular Weight | 274.88 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | (3S,4R)-3-butyl-1-cyclohexylpiperidin-4-amine;hydrochloride |
| SMILES | CCCC[C@H]1CN(C2CCCCC2)CC[C@H]1N.Cl |
| InChI | InChI=1S/C15H30N2.ClH/c1-2-3-7-13-12-17(11-10-15(13)16)14-8-5-4-6-9-14;/h13-15H,2-12,16H2,1H3;1H/t13-,15+;/m0./s1 |
| InChIKey | DQTGNKGDLBEUJI-NQQJLSKUSA-N |
| XLogP | 3.58 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.88 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |