C18H21NO4 — CID 45254832
(2S,3S)-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]butanamide (PubChem CID 45254832) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is (2S,3S)-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]butanamide.
| Compound Name | (2S,3S)-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]butanamide |
|---|---|
| PubChem CID | 45254832 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | (2S,3S)-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]butanamide |
| SMILES | C[C@H](O)[C@](C)(OCc1ccc(-c2ccccc2)cc1)C(=O)NO |
| InChI | InChI=1S/C18H21NO4/c1-13(20)18(2,17(21)19-22)23-12-14-8-10-16(11-9-14)15-6-4-3-5-7-15/h3-11,13,20,22H,12H2,1-2H3,(H,19,21)/t13-,18-/m0/s1 |
| InChIKey | HKHLJBBDUOPRQN-UGSOOPFHSA-N |
| XLogP | 2.52 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|