About N,2-bis(2-chlorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine
N,2-bis(2-chlorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine (PubChem CID 45254923) has the molecular formula C20H15Cl2N3
and a molecular weight of 368.27 g/mol. Its IUPAC name is N,2-bis(2-chlorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine.
Molecular Properties
| Compound Name | N,2-bis(2-chlorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine |
| PubChem CID | 45254923 |
| Molecular Formula | C20H15Cl2N3 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | N,2-bis(2-chlorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine |
| SMILES | Cc1cccc2nc(-c3ccccc3Cl)c(Nc3ccccc3Cl)n12 |
| InChI | InChI=1S/C20H15Cl2N3/c1-13-7-6-12-18-24-19(14-8-2-3-9-15(14)21)20(25(13)18)23-17-11-5-4-10-16(17)22/h2-12,23H,1H3 |
| InChIKey | DJACEHGQRDRVLY-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,2-bis(2-chlorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-bis(2-chlorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine?
The IUPAC name of N,2-bis(2-chlorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine (CID 45254923) is N,2-bis(2-chlorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine.
What is the SMILES notation for N,2-bis(2-chlorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine?
The canonical SMILES for N,2-bis(2-chlorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine is Cc1cccc2nc(-c3ccccc3Cl)c(Nc3ccccc3Cl)n12.
What is the InChIKey of N,2-bis(2-chlorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine?
The InChIKey is DJACEHGQRDRVLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15Cl2N3/c1-13-7-6-12-18-24-19(14-8-2-3-9-15(14)21)20(25(13)18)23-17-11-5-4-10-16(17)22/h2-12,23H,1H3.
What are the key properties of N,2-bis(2-chlorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine?
N,2-bis(2-chlorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine has a molecular weight of 368.27 g/mol, XLogP of 6.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-bis(2-chlorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine is sourced from PubChem (CID 45254923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).