About 6-bromo-8-ethyl-2,2-dimethyl-3,4-dihydrochromene
6-bromo-8-ethyl-2,2-dimethyl-3,4-dihydrochromene (PubChem CID 45255786) has the molecular formula C13H17BrO
and a molecular weight of 269.18 g/mol. Its IUPAC name is 6-bromo-8-ethyl-2,2-dimethyl-3,4-dihydrochromene.
Molecular Properties
| Compound Name | 6-bromo-8-ethyl-2,2-dimethyl-3,4-dihydrochromene |
| PubChem CID | 45255786 |
| Molecular Formula | C13H17BrO |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 6-bromo-8-ethyl-2,2-dimethyl-3,4-dihydrochromene |
| SMILES | CCc1cc(Br)cc2c1OC(C)(C)CC2 |
| InChI | InChI=1S/C13H17BrO/c1-4-9-7-11(14)8-10-5-6-13(2,3)15-12(9)10/h7-8H,4-6H2,1-3H3 |
| InChIKey | HWSJGDUMOFWZKX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-8-ethyl-2,2-dimethyl-3,4-dihydrochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-8-ethyl-2,2-dimethyl-3,4-dihydrochromene?
The IUPAC name of 6-bromo-8-ethyl-2,2-dimethyl-3,4-dihydrochromene (CID 45255786) is 6-bromo-8-ethyl-2,2-dimethyl-3,4-dihydrochromene.
What is the SMILES notation for 6-bromo-8-ethyl-2,2-dimethyl-3,4-dihydrochromene?
The canonical SMILES for 6-bromo-8-ethyl-2,2-dimethyl-3,4-dihydrochromene is CCc1cc(Br)cc2c1OC(C)(C)CC2.
What is the InChIKey of 6-bromo-8-ethyl-2,2-dimethyl-3,4-dihydrochromene?
The InChIKey is HWSJGDUMOFWZKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BrO/c1-4-9-7-11(14)8-10-5-6-13(2,3)15-12(9)10/h7-8H,4-6H2,1-3H3.
What are the key properties of 6-bromo-8-ethyl-2,2-dimethyl-3,4-dihydrochromene?
6-bromo-8-ethyl-2,2-dimethyl-3,4-dihydrochromene has a molecular weight of 269.18 g/mol, XLogP of 4.12, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-8-ethyl-2,2-dimethyl-3,4-dihydrochromene is sourced from PubChem (CID 45255786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).