C21H21FN2O6 — CID 45255855
(2S,3R)-2-[[4-(4-fluorophenyl)phenyl]methoxy]-N,3-dihydroxy-3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]-2-methylpropanamide (PubChem CID 45255855) has the molecular formula C21H21FN2O6 and a molecular weight of 416.41 g/mol. Its IUPAC name is (2S,3R)-2-[[4-(4-fluorophenyl)phenyl]methoxy]-N,3-dihydroxy-3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]-2-methylpropanamide.
| Compound Name | (2S,3R)-2-[[4-(4-fluorophenyl)phenyl]methoxy]-N,3-dihydroxy-3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 45255855 |
| Molecular Formula | C21H21FN2O6 |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (2S,3R)-2-[[4-(4-fluorophenyl)phenyl]methoxy]-N,3-dihydroxy-3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]-2-methylpropanamide |
| SMILES | C[C@@](OCc1ccc(-c2ccc(F)cc2)cc1)(C(=O)NO)[C@H](O)c1cc(CO)on1 |
| InChI | InChI=1S/C21H21FN2O6/c1-21(20(27)23-28,19(26)18-10-17(11-25)30-24-18)29-12-13-2-4-14(5-3-13)15-6-8-16(22)9-7-15/h2-10,19,25-26,28H,11-12H2,1H3,(H,23,27)/t19-,21+/m1/s1 |
| InChIKey | JMQORFGALIYVFN-CTNGQTDRSA-N |
| XLogP | 2.49 |
| TPSA | 125.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|