About 2,2-dimethyl-6-phenyl-8-propan-2-yl-3,4-dihydrochromene
2,2-dimethyl-6-phenyl-8-propan-2-yl-3,4-dihydrochromene (PubChem CID 45255973) has the molecular formula C20H24O
and a molecular weight of 280.41 g/mol. Its IUPAC name is 2,2-dimethyl-6-phenyl-8-propan-2-yl-3,4-dihydrochromene.
Molecular Properties
| Compound Name | 2,2-dimethyl-6-phenyl-8-propan-2-yl-3,4-dihydrochromene |
| PubChem CID | 45255973 |
| Molecular Formula | C20H24O |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2,2-dimethyl-6-phenyl-8-propan-2-yl-3,4-dihydrochromene |
| SMILES | CC(C)c1cc(-c2ccccc2)cc2c1OC(C)(C)CC2 |
| InChI | InChI=1S/C20H24O/c1-14(2)18-13-17(15-8-6-5-7-9-15)12-16-10-11-20(3,4)21-19(16)18/h5-9,12-14H,10-11H2,1-4H3 |
| InChIKey | WHLGFINTPZDHIM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dimethyl-6-phenyl-8-propan-2-yl-3,4-dihydrochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-6-phenyl-8-propan-2-yl-3,4-dihydrochromene?
The IUPAC name of 2,2-dimethyl-6-phenyl-8-propan-2-yl-3,4-dihydrochromene (CID 45255973) is 2,2-dimethyl-6-phenyl-8-propan-2-yl-3,4-dihydrochromene.
What is the SMILES notation for 2,2-dimethyl-6-phenyl-8-propan-2-yl-3,4-dihydrochromene?
The canonical SMILES for 2,2-dimethyl-6-phenyl-8-propan-2-yl-3,4-dihydrochromene is CC(C)c1cc(-c2ccccc2)cc2c1OC(C)(C)CC2.
What is the InChIKey of 2,2-dimethyl-6-phenyl-8-propan-2-yl-3,4-dihydrochromene?
The InChIKey is WHLGFINTPZDHIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24O/c1-14(2)18-13-17(15-8-6-5-7-9-15)12-16-10-11-20(3,4)21-19(16)18/h5-9,12-14H,10-11H2,1-4H3.
What are the key properties of 2,2-dimethyl-6-phenyl-8-propan-2-yl-3,4-dihydrochromene?
2,2-dimethyl-6-phenyl-8-propan-2-yl-3,4-dihydrochromene has a molecular weight of 280.41 g/mol, XLogP of 5.58, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-6-phenyl-8-propan-2-yl-3,4-dihydrochromene is sourced from PubChem (CID 45255973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).