About N-butan-2-ylhexanamide
N-butan-2-ylhexanamide (PubChem CID 4525628) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is N-butan-2-ylhexanamide.
Molecular Properties
| Compound Name | N-butan-2-ylhexanamide |
| PubChem CID | 4525628 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | N-butan-2-ylhexanamide |
| SMILES | CCCCCC(=O)NC(C)CC |
| InChI | InChI=1S/C10H21NO/c1-4-6-7-8-10(12)11-9(3)5-2/h9H,4-8H2,1-3H3,(H,11,12) |
| InChIKey | QNAZDRVGIXIMPZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-ylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-ylhexanamide?
The IUPAC name of N-butan-2-ylhexanamide (CID 4525628) is N-butan-2-ylhexanamide.
What is the SMILES notation for N-butan-2-ylhexanamide?
The canonical SMILES for N-butan-2-ylhexanamide is CCCCCC(=O)NC(C)CC.
What is the InChIKey of N-butan-2-ylhexanamide?
The InChIKey is QNAZDRVGIXIMPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO/c1-4-6-7-8-10(12)11-9(3)5-2/h9H,4-8H2,1-3H3,(H,11,12).
What are the key properties of N-butan-2-ylhexanamide?
N-butan-2-ylhexanamide has a molecular weight of 171.28 g/mol, XLogP of 2.48, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-ylhexanamide is sourced from PubChem (CID 4525628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).